C29H31FN4O3S — CID 10840039
1-[1-(3,3-dimethylbutyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-(3-methylsulfanylphenyl)urea (PubChem CID 10840039) has the molecular formula C29H31FN4O3S and a molecular weight of 534.66 g/mol. Its IUPAC name is 1-[1-(3,3-dimethylbutyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-(3-methylsulfanylphenyl)urea.
| Compound Name | 1-[1-(3,3-dimethylbutyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-(3-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 10840039 |
| Molecular Formula | C29H31FN4O3S |
| Molecular Weight | 534.66 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | 1-[1-(3,3-dimethylbutyl)-5-(2-fluorophenyl)-2,4-dioxo-1,5-benzodiazepin-3-yl]-3-(3-methylsulfanylphenyl)urea |
| SMILES | CSc1cccc(NC(=O)NC2C(=O)N(CCC(C)(C)C)c3ccccc3N(c3ccccc3F)C2=O)c1 |
| InChI | InChI=1S/C29H31FN4O3S/c1-29(2,3)16-17-33-23-14-7-8-15-24(23)34(22-13-6-5-12-21(22)30)27(36)25(26(33)35)32-28(37)31-19-10-9-11-20(18-19)38-4/h5-15,18,25H,16-17H2,1-4H3,(H2,31,32,37) |
| InChIKey | LKPXKRQIQWQJOR-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.66 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|