C28H44O6SSi — CID 10840085
methyl (3Z,9Z)-1-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxycyclotrideca-3,9-diene-1-carboxylate (PubChem CID 10840085) has the molecular formula C28H44O6SSi and a molecular weight of 536.81 g/mol. Its IUPAC name is methyl (3Z,9Z)-1-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxycyclotrideca-3,9-diene-1-carboxylate.
| Compound Name | methyl (3Z,9Z)-1-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxycyclotrideca-3,9-diene-1-carboxylate |
|---|---|
| PubChem CID | 10840085 |
| Molecular Formula | C28H44O6SSi |
| Molecular Weight | 536.81 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | methyl (3Z,9Z)-1-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxycyclotrideca-3,9-diene-1-carboxylate |
| SMILES | COC(=O)C1(S(=O)(=O)c2ccccc2)CCC/C=C\CCCC(O)/C=C(\CO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C28H44O6SSi/c1-27(2,3)36(5,6)34-22-23-20-24(29)16-12-9-7-8-10-15-19-28(21-23,26(30)33-4)35(31,32)25-17-13-11-14-18-25/h7-8,11,13-14,17-18,20,24,29H,9-10,12,15-16,19,21-22H2,1-6H3/b8-7-,23-20- |
| InChIKey | CGVNIQFGUUTZHV-HPQPYQJGSA-N |
| XLogP | 5.98 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.81 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|