C37H34N2O2 — CID 10840132
4-(2,6,6,9,9-pentamethyl-2,13-diazahexacyclo[13.12.0.03,12.05,10.018,27.020,25]heptacosa-1(15),3(12),4,10,13,16,18,20,22,24,26-undecaen-14-yl)benzoic acid (PubChem CID 10840132) has the molecular formula C37H34N2O2 and a molecular weight of 538.69 g/mol. Its IUPAC name is 4-(2,6,6,9,9-pentamethyl-2,13-diazahexacyclo[13.12.0.03,12.05,10.018,27.020,25]heptacosa-1(15),3(12),4,10,13,16,18,20,22,24,26-undecaen-14-yl)benzoic acid.
| Compound Name | 4-(2,6,6,9,9-pentamethyl-2,13-diazahexacyclo[13.12.0.03,12.05,10.018,27.020,25]heptacosa-1(15),3(12),4,10,13,16,18,20,22,24,26-undecaen-14-yl)benzoic acid |
|---|---|
| PubChem CID | 10840132 |
| Molecular Formula | C37H34N2O2 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | 4-(2,6,6,9,9-pentamethyl-2,13-diazahexacyclo[13.12.0.03,12.05,10.018,27.020,25]heptacosa-1(15),3(12),4,10,13,16,18,20,22,24,26-undecaen-14-yl)benzoic acid |
| SMILES | CN1c2cc3c(cc2N=C(c2ccc(C(=O)O)cc2)c2ccc4cc5ccccc5cc4c21)C(C)(C)CCC3(C)C |
| InChI | InChI=1S/C37H34N2O2/c1-36(2)16-17-37(3,4)30-21-32-31(20-29(30)36)38-33(22-10-12-23(13-11-22)35(40)41)27-15-14-26-18-24-8-6-7-9-25(24)19-28(26)34(27)39(32)5/h6-15,18-21H,16-17H2,1-5H3,(H,40,41) |
| InChIKey | YGLJSCGPHIEGNL-UHFFFAOYSA-N |
| XLogP | 9.29 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 9.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|