C30H27N3O7 — CID 10840193
dimethyl (1R,2R,7S)-2-benzamido-7-(4-methoxyphenyl)-3-oxo-1-phenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-5,6-dicarboxylate (PubChem CID 10840193) has the molecular formula C30H27N3O7 and a molecular weight of 541.56 g/mol. Its IUPAC name is dimethyl (1R,2R,7S)-2-benzamido-7-(4-methoxyphenyl)-3-oxo-1-phenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-5,6-dicarboxylate.
| Compound Name | dimethyl (1R,2R,7S)-2-benzamido-7-(4-methoxyphenyl)-3-oxo-1-phenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-5,6-dicarboxylate |
|---|---|
| PubChem CID | 10840193 |
| Molecular Formula | C30H27N3O7 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | dimethyl (1R,2R,7S)-2-benzamido-7-(4-methoxyphenyl)-3-oxo-1-phenyl-2,7-dihydro-1H-pyrazolo[1,2-a]pyrazole-5,6-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)N2C(=O)[C@H](NC(=O)c3ccccc3)[C@@H](c3ccccc3)N2[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H27N3O7/c1-38-21-16-14-19(15-17-21)24-22(29(36)39-2)26(30(37)40-3)33-28(35)23(31-27(34)20-12-8-5-9-13-20)25(32(24)33)18-10-6-4-7-11-18/h4-17,23-25H,1-3H3,(H,31,34)/t23-,24+,25-/m1/s1 |
| InChIKey | BEBWOINIQLKRMQ-DSNGMDLFSA-N |
| XLogP | 2.95 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |