C19H21N3O4 — CID 1084020
3-pyridin-4-yl-5-(3,4,5-triethoxyphenyl)-1,2,4-oxadiazole (PubChem CID 1084020) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 3-pyridin-4-yl-5-(3,4,5-triethoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 3-pyridin-4-yl-5-(3,4,5-triethoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 1084020 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 3-pyridin-4-yl-5-(3,4,5-triethoxyphenyl)-1,2,4-oxadiazole |
| SMILES | CCOc1cc(-c2nc(-c3ccncc3)no2)cc(OCC)c1OCC |
| InChI | InChI=1S/C19H21N3O4/c1-4-23-15-11-14(12-16(24-5-2)17(15)25-6-3)19-21-18(22-26-19)13-7-9-20-10-8-13/h7-12H,4-6H2,1-3H3 |
| InChIKey | ZQUDXBBWUXEBGA-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 79.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |