C26H49NO3Sn — CID 10840214
[(E,3R,4R)-2,4-dimethyl-7-oxo-7-[[(E)-3-tributylstannylprop-2-enyl]amino]hept-5-en-3-yl] acetate (PubChem CID 10840214) has the molecular formula C26H49NO3Sn and a molecular weight of 542.39 g/mol. Its IUPAC name is [(E,3R,4R)-2,4-dimethyl-7-oxo-7-[[(E)-3-tributylstannylprop-2-enyl]amino]hept-5-en-3-yl] acetate.
| Compound Name | [(E,3R,4R)-2,4-dimethyl-7-oxo-7-[[(E)-3-tributylstannylprop-2-enyl]amino]hept-5-en-3-yl] acetate |
|---|---|
| PubChem CID | 10840214 |
| Molecular Formula | C26H49NO3Sn |
| Molecular Weight | 542.39 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | [(E,3R,4R)-2,4-dimethyl-7-oxo-7-[[(E)-3-tributylstannylprop-2-enyl]amino]hept-5-en-3-yl] acetate |
| SMILES | CCCC[Sn](/C=C/CNC(=O)/C=C/[C@@H](C)[C@H](OC(C)=O)C(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C14H22NO3.3C4H9.Sn/c1-6-9-15-13(17)8-7-11(4)14(10(2)3)18-12(5)16;3*1-3-4-2;/h1,6-8,10-11,14H,9H2,2-5H3,(H,15,17);3*1,3-4H2,2H3;/b6-1?,8-7+;;;;/t11-,14-;;;;/m1..../s1 |
| InChIKey | DDJKEXJXARZJSH-YEYCGIKNSA-N |
| XLogP | 6.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.39 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|