C19H31BrF2NO6PS — CID 10840403
(2S,3R)-2-bromo-4-diethoxyphosphoryl-1-[(1R,5R,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-4,4-difluoro-3-methylbutan-1-one (PubChem CID 10840403) has the molecular formula C19H31BrF2NO6PS and a molecular weight of 550.40 g/mol. Its IUPAC name is (2S,3R)-2-bromo-4-diethoxyphosphoryl-1-[(1R,5R,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-4,4-difluoro-3-methylbutan-1-one.
| Compound Name | (2S,3R)-2-bromo-4-diethoxyphosphoryl-1-[(1R,5R,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-4,4-difluoro-3-methylbutan-1-one |
|---|---|
| PubChem CID | 10840403 |
| Molecular Formula | C19H31BrF2NO6PS |
| Molecular Weight | 550.40 g/mol |
| Exact Mass | 549.08 |
| IUPAC Name | (2S,3R)-2-bromo-4-diethoxyphosphoryl-1-[(1R,5R,7S)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-4,4-difluoro-3-methylbutan-1-one |
| SMILES | CCOP(=O)(OCC)C(F)(F)[C@@H](C)[C@H](Br)C(=O)N1[C@@H]2C[C@@H]3CC[C@@]2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C19H31BrF2NO6PS/c1-6-28-30(25,29-7-2)19(21,22)12(3)15(20)16(24)23-14-10-13-8-9-18(14,17(13,4)5)11-31(23,26)27/h12-15H,6-11H2,1-5H3/t12-,13-,14+,15-,18-/m0/s1 |
| InChIKey | WMBWTCMFOARCKD-GLRLOKQVSA-N |
| XLogP | 4.61 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|