C32H29N3O6S — CID 10841041
S-benzyl (1R,12S)-4-methyl-7-oxo-10-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-3-carbothioate (PubChem CID 10841041) has the molecular formula C32H29N3O6S and a molecular weight of 583.67 g/mol. Its IUPAC name is S-benzyl (1R,12S)-4-methyl-7-oxo-10-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-3-carbothioate.
| Compound Name | S-benzyl (1R,12S)-4-methyl-7-oxo-10-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-3-carbothioate |
|---|---|
| PubChem CID | 10841041 |
| Molecular Formula | C32H29N3O6S |
| Molecular Weight | 583.67 g/mol |
| Exact Mass | 583.18 |
| IUPAC Name | S-benzyl (1R,12S)-4-methyl-7-oxo-10-(5,6,7-trimethoxy-1H-indole-2-carbonyl)-5,10-diazatetracyclo[7.4.0.01,12.02,6]trideca-2(6),3,8-triene-3-carbothioate |
| SMILES | COc1cc2cc(C(=O)N3C[C@H]4C[C@@]45C3=CC(=O)c3[nH]c(C)c(C(=O)SCc4ccccc4)c35)[nH]c2c(OC)c1OC |
| InChI | InChI=1S/C32H29N3O6S/c1-16-24(31(38)42-15-17-8-6-5-7-9-17)25-27(33-16)21(36)12-23-32(25)13-19(32)14-35(23)30(37)20-10-18-11-22(39-2)28(40-3)29(41-4)26(18)34-20/h5-12,19,33-34H,13-15H2,1-4H3/t19-,32+/m1/s1 |
| InChIKey | HMODZNXBMFLNIV-WHUARKNTSA-N |
| XLogP | 5.40 |
| TPSA | 113.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.67 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|