C37H48O4Si — CID 10841062
tert-butyl-diphenyl-[3-[[(2R,5S,6S)-5-phenylmethoxy-1,7-dioxaspiro[5.5]undecan-2-yl]methyl]but-3-enoxy]silane (PubChem CID 10841062) has the molecular formula C37H48O4Si and a molecular weight of 584.87 g/mol. Its IUPAC name is tert-butyl-diphenyl-[3-[[(2R,5S,6S)-5-phenylmethoxy-1,7-dioxaspiro[5.5]undecan-2-yl]methyl]but-3-enoxy]silane.
| Compound Name | tert-butyl-diphenyl-[3-[[(2R,5S,6S)-5-phenylmethoxy-1,7-dioxaspiro[5.5]undecan-2-yl]methyl]but-3-enoxy]silane |
|---|---|
| PubChem CID | 10841062 |
| Molecular Formula | C37H48O4Si |
| Molecular Weight | 584.87 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | tert-butyl-diphenyl-[3-[[(2R,5S,6S)-5-phenylmethoxy-1,7-dioxaspiro[5.5]undecan-2-yl]methyl]but-3-enoxy]silane |
| SMILES | C=C(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C[C@H]1CC[C@H](OCc2ccccc2)[C@]2(CCCCO2)O1 |
| InChI | InChI=1S/C37H48O4Si/c1-30(24-27-40-42(36(2,3)4,33-18-10-6-11-19-33)34-20-12-7-13-21-34)28-32-22-23-35(37(41-32)25-14-15-26-39-37)38-29-31-16-8-5-9-17-31/h5-13,16-21,32,35H,1,14-15,22-29H2,2-4H3/t32-,35+,37+/m1/s1 |
| InChIKey | CZCBPANUTATJAV-JRTMJWCBSA-N |
| XLogP | 7.56 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.87 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|