About 4,6-dibromo-1-(4,6-dibromo-2-hydroxynaphthalen-1-yl)naphthalen-2-ol
4,6-dibromo-1-(4,6-dibromo-2-hydroxynaphthalen-1-yl)naphthalen-2-ol (PubChem CID 10841304) has the molecular formula C20H10Br4O2
and a molecular weight of 601.91 g/mol. Its IUPAC name is 4,6-dibromo-1-(4,6-dibromo-2-hydroxynaphthalen-1-yl)naphthalen-2-ol.
Molecular Properties
| Compound Name | 4,6-dibromo-1-(4,6-dibromo-2-hydroxynaphthalen-1-yl)naphthalen-2-ol |
| PubChem CID | 10841304 |
| Molecular Formula | C20H10Br4O2 |
| Molecular Weight | 601.91 g/mol |
| Exact Mass | 597.74 |
| IUPAC Name | 4,6-dibromo-1-(4,6-dibromo-2-hydroxynaphthalen-1-yl)naphthalen-2-ol |
| SMILES | Oc1cc(Br)c2cc(Br)ccc2c1-c1c(O)cc(Br)c2cc(Br)ccc12 |
| InChI | InChI=1S/C20H10Br4O2/c21-9-1-3-11-13(5-9)15(23)7-17(25)19(11)20-12-4-2-10(22)6-14(12)16(24)8-18(20)26/h1-8,25-26H |
| InChIKey | CCLXZUVFAXXNBA-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 601.91 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,6-dibromo-1-(4,6-dibromo-2-hydroxynaphthalen-1-yl)naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dibromo-1-(4,6-dibromo-2-hydroxynaphthalen-1-yl)naphthalen-2-ol?
The IUPAC name of 4,6-dibromo-1-(4,6-dibromo-2-hydroxynaphthalen-1-yl)naphthalen-2-ol (CID 10841304) is 4,6-dibromo-1-(4,6-dibromo-2-hydroxynaphthalen-1-yl)naphthalen-2-ol.
What is the SMILES notation for 4,6-dibromo-1-(4,6-dibromo-2-hydroxynaphthalen-1-yl)naphthalen-2-ol?
The canonical SMILES for 4,6-dibromo-1-(4,6-dibromo-2-hydroxynaphthalen-1-yl)naphthalen-2-ol is Oc1cc(Br)c2cc(Br)ccc2c1-c1c(O)cc(Br)c2cc(Br)ccc12.
What is the InChIKey of 4,6-dibromo-1-(4,6-dibromo-2-hydroxynaphthalen-1-yl)naphthalen-2-ol?
The InChIKey is CCLXZUVFAXXNBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H10Br4O2/c21-9-1-3-11-13(5-9)15(23)7-17(25)19(11)20-12-4-2-10(22)6-14(12)16(24)8-18(20)26/h1-8,25-26H.
What are the key properties of 4,6-dibromo-1-(4,6-dibromo-2-hydroxynaphthalen-1-yl)naphthalen-2-ol?
4,6-dibromo-1-(4,6-dibromo-2-hydroxynaphthalen-1-yl)naphthalen-2-ol has a molecular weight of 601.91 g/mol, XLogP of 8.12, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dibromo-1-(4,6-dibromo-2-hydroxynaphthalen-1-yl)naphthalen-2-ol is sourced from PubChem (CID 10841304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).