C30H25F3N4O3S2 — CID 10841426
N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-4-[4-(3,4,5-trifluorophenyl)-1,3-thiazol-2-yl]benzenesulfonamide (PubChem CID 10841426) has the molecular formula C30H25F3N4O3S2 and a molecular weight of 610.68 g/mol. Its IUPAC name is N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-4-[4-(3,4,5-trifluorophenyl)-1,3-thiazol-2-yl]benzenesulfonamide.
| Compound Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-4-[4-(3,4,5-trifluorophenyl)-1,3-thiazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 10841426 |
| Molecular Formula | C30H25F3N4O3S2 |
| Molecular Weight | 610.68 g/mol |
| Exact Mass | 610.13 |
| IUPAC Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-4-[4-(3,4,5-trifluorophenyl)-1,3-thiazol-2-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(CCNC[C@H](O)c2cccnc2)cc1)c1ccc(-c2nc(-c3cc(F)c(F)c(F)c3)cs2)cc1 |
| InChI | InChI=1S/C30H25F3N4O3S2/c31-25-14-22(15-26(32)29(25)33)27-18-41-30(36-27)20-5-9-24(10-6-20)42(39,40)37-23-7-3-19(4-8-23)11-13-35-17-28(38)21-2-1-12-34-16-21/h1-10,12,14-16,18,28,35,37-38H,11,13,17H2/t28-/m0/s1 |
| InChIKey | YUXRZMJBOMYGHS-NDEPHWFRSA-N |
| XLogP | 5.96 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.68 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|