C36H46N2O7 — CID 10841538
(3S,10R,13E,16S)-6,6-dimethyl-3-(2-methylpropyl)-16-[(E,2R)-4-phenylbut-3-en-2-yl]-10-(phenylmethoxymethyl)-1,4-dioxa-8,11-diazacyclohexadec-13-ene-2,5,9,12-tetrone (PubChem CID 10841538) has the molecular formula C36H46N2O7 and a molecular weight of 618.77 g/mol. Its IUPAC name is (3S,10R,13E,16S)-6,6-dimethyl-3-(2-methylpropyl)-16-[(E,2R)-4-phenylbut-3-en-2-yl]-10-(phenylmethoxymethyl)-1,4-dioxa-8,11-diazacyclohexadec-13-ene-2,5,9,12-tetrone.
| Compound Name | (3S,10R,13E,16S)-6,6-dimethyl-3-(2-methylpropyl)-16-[(E,2R)-4-phenylbut-3-en-2-yl]-10-(phenylmethoxymethyl)-1,4-dioxa-8,11-diazacyclohexadec-13-ene-2,5,9,12-tetrone |
|---|---|
| PubChem CID | 10841538 |
| Molecular Formula | C36H46N2O7 |
| Molecular Weight | 618.77 g/mol |
| Exact Mass | 618.33 |
| IUPAC Name | (3S,10R,13E,16S)-6,6-dimethyl-3-(2-methylpropyl)-16-[(E,2R)-4-phenylbut-3-en-2-yl]-10-(phenylmethoxymethyl)-1,4-dioxa-8,11-diazacyclohexadec-13-ene-2,5,9,12-tetrone |
| SMILES | CC(C)C[C@@H]1OC(=O)C(C)(C)CNC(=O)[C@@H](COCc2ccccc2)NC(=O)/C=C/C[C@@H]([C@H](C)/C=C/c2ccccc2)OC1=O |
| InChI | InChI=1S/C36H46N2O7/c1-25(2)21-31-34(41)44-30(26(3)19-20-27-13-8-6-9-14-27)17-12-18-32(39)38-29(23-43-22-28-15-10-7-11-16-28)33(40)37-24-36(4,5)35(42)45-31/h6-16,18-20,25-26,29-31H,17,21-24H2,1-5H3,(H,37,40)(H,38,39)/b18-12+,20-19+/t26-,29-,30+,31+/m1/s1 |
| InChIKey | XXUZGZURNRIYNO-JKTGWXTDSA-N |
| XLogP | 5.01 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.77 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |