C36H28ClFN4O4 — CID 10841755
[(2R,3R,4S,5R)-5-(6-chloropurin-9-yl)-4-fluoro-2-(trityloxymethyl)oxolan-3-yl] benzoate (PubChem CID 10841755) has the molecular formula C36H28ClFN4O4 and a molecular weight of 635.10 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-5-(6-chloropurin-9-yl)-4-fluoro-2-(trityloxymethyl)oxolan-3-yl] benzoate.
| Compound Name | [(2R,3R,4S,5R)-5-(6-chloropurin-9-yl)-4-fluoro-2-(trityloxymethyl)oxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 10841755 |
| Molecular Formula | C36H28ClFN4O4 |
| Molecular Weight | 635.10 g/mol |
| Exact Mass | 634.18 |
| IUPAC Name | [(2R,3R,4S,5R)-5-(6-chloropurin-9-yl)-4-fluoro-2-(trityloxymethyl)oxolan-3-yl] benzoate |
| SMILES | O=C(O[C@H]1[C@H](F)[C@H](n2cnc3c(Cl)ncnc32)O[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H28ClFN4O4/c37-32-30-33(40-22-39-32)42(23-41-30)34-29(38)31(46-35(43)24-13-5-1-6-14-24)28(45-34)21-44-36(25-15-7-2-8-16-25,26-17-9-3-10-18-26)27-19-11-4-12-20-27/h1-20,22-23,28-29,31,34H,21H2/t28-,29+,31-,34-/m1/s1 |
| InChIKey | WSYWMYKEXIZQFZ-QPBRMJRSSA-N |
| XLogP | 6.95 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.10 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|