C30H34Br2O7 — CID 10842136
(5S,13S)-5,13-bis(4-bromophenyl)-19,21-dimethoxy-3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(20),17(21),18-triene (PubChem CID 10842136) has the molecular formula C30H34Br2O7 and a molecular weight of 666.40 g/mol. Its IUPAC name is (5S,13S)-5,13-bis(4-bromophenyl)-19,21-dimethoxy-3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(20),17(21),18-triene.
| Compound Name | (5S,13S)-5,13-bis(4-bromophenyl)-19,21-dimethoxy-3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(20),17(21),18-triene |
|---|---|
| PubChem CID | 10842136 |
| Molecular Formula | C30H34Br2O7 |
| Molecular Weight | 666.40 g/mol |
| Exact Mass | 664.07 |
| IUPAC Name | (5S,13S)-5,13-bis(4-bromophenyl)-19,21-dimethoxy-3,6,9,12,15-pentaoxabicyclo[15.3.1]henicosa-1(20),17(21),18-triene |
| SMILES | COc1cc2c(OC)c(c1)COC[C@H](c1ccc(Br)cc1)OCCOCCO[C@@H](c1ccc(Br)cc1)COC2 |
| InChI | InChI=1S/C30H34Br2O7/c1-33-27-15-23-17-36-19-28(21-3-7-25(31)8-4-21)38-13-11-35-12-14-39-29(22-5-9-26(32)10-6-22)20-37-18-24(16-27)30(23)34-2/h3-10,15-16,28-29H,11-14,17-20H2,1-2H3/t28-,29-/m1/s1 |
| InChIKey | HQUFSWLOSQZWDA-FQLXRVMXSA-N |
| XLogP | 6.81 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.40 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |