C33H63N7O8 — CID 10842321
tert-butyl N-[3-[4-[[4-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-4-oxobutanoyl]amino]butylamino]propyl]carbamate (PubChem CID 10842321) has the molecular formula C33H63N7O8 and a molecular weight of 685.91 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[[4-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-4-oxobutanoyl]amino]butylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[[4-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-4-oxobutanoyl]amino]butylamino]propyl]carbamate |
|---|---|
| PubChem CID | 10842321 |
| Molecular Formula | C33H63N7O8 |
| Molecular Weight | 685.91 g/mol |
| Exact Mass | 685.47 |
| IUPAC Name | tert-butyl N-[3-[4-[[4-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]hexylamino]-4-oxobutanoyl]amino]butylamino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCNCCCCNC(=O)CCC(=O)NCCCCCCN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H63N7O8/c1-31(2,3)46-28(43)38-24-16-20-34-19-14-15-22-36-26(42)18-17-25(41)35-21-12-10-11-13-23-37-27(39-29(44)47-32(4,5)6)40-30(45)48-33(7,8)9/h34H,10-24H2,1-9H3,(H,35,41)(H,36,42)(H,38,43)(H2,37,39,40,44,45) |
| InChIKey | XDFBJVFPIAJENK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 197.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.91 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|