C29H11F15N2O2 — CID 10842465
[5-[[5-[hydroxy-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanol (PubChem CID 10842465) has the molecular formula C29H11F15N2O2 and a molecular weight of 704.39 g/mol. Its IUPAC name is [5-[[5-[hydroxy-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanol.
| Compound Name | [5-[[5-[hydroxy-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanol |
|---|---|
| PubChem CID | 10842465 |
| Molecular Formula | C29H11F15N2O2 |
| Molecular Weight | 704.39 g/mol |
| Exact Mass | 704.06 |
| IUPAC Name | [5-[[5-[hydroxy-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methyl]-1H-pyrrol-2-yl]-(2,3,4,5,6-pentafluorophenyl)methanol |
| SMILES | OC(c1ccc(C(c2ccc(C(O)c3c(F)c(F)c(F)c(F)c3F)[nH]2)c2c(F)c(F)c(F)c(F)c2F)[nH]1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C29H11F15N2O2/c30-13-10(14(31)20(37)25(42)19(13)36)9(5-1-3-7(45-5)28(47)11-15(32)21(38)26(43)22(39)16(11)33)6-2-4-8(46-6)29(48)12-17(34)23(40)27(44)24(41)18(12)35/h1-4,9,28-29,45-48H |
| InChIKey | PBTVAZKGXFKGNE-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.39 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|