C19H26F6I2N2O5 — CID 10842636
3-[4-[2-(dimethylazaniumyl)ethyl]-2,6-diiodophenoxy]propyl-dimethylazanium;bis(2,2,2-trifluoroacetate) (PubChem CID 10842636) has the molecular formula C19H26F6I2N2O5 and a molecular weight of 730.22 g/mol. Its IUPAC name is 3-[4-[2-(dimethylazaniumyl)ethyl]-2,6-diiodophenoxy]propyl-dimethylazanium;bis(2,2,2-trifluoroacetate).
| Compound Name | 3-[4-[2-(dimethylazaniumyl)ethyl]-2,6-diiodophenoxy]propyl-dimethylazanium;bis(2,2,2-trifluoroacetate) |
|---|---|
| PubChem CID | 10842636 |
| Molecular Formula | C19H26F6I2N2O5 |
| Molecular Weight | 730.22 g/mol |
| Exact Mass | 729.98 |
| IUPAC Name | 3-[4-[2-(dimethylazaniumyl)ethyl]-2,6-diiodophenoxy]propyl-dimethylazanium;bis(2,2,2-trifluoroacetate) |
| SMILES | C[NH+](C)CCCOc1c(I)cc(CC[NH+](C)C)cc1I.O=C([O-])C(F)(F)F.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C15H24I2N2O.2C2HF3O2/c1-18(2)7-5-9-20-15-13(16)10-12(11-14(15)17)6-8-19(3)4;2*3-2(4,5)1(6)7/h10-11H,5-9H2,1-4H3;2*(H,6,7) |
| InChIKey | OKTZNGZNBYSZGN-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 98.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.22 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|