C17H9F17N2O6S3 — CID 10842801
2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate (PubChem CID 10842801) has the molecular formula C17H9F17N2O6S3 and a molecular weight of 756.43 g/mol. Its IUPAC name is 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate.
| Compound Name | 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 10842801 |
| Molecular Formula | C17H9F17N2O6S3 |
| Molecular Weight | 756.43 g/mol |
| Exact Mass | 755.94 |
| IUPAC Name | 2-[(2-sulfamoyl-1,3-benzothiazol-6-yl)oxy]ethyl 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
| SMILES | NS(=O)(=O)c1nc2ccc(OCCOS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2s1 |
| InChI | InChI=1S/C17H9F17N2O6S3/c18-10(19,12(22,23)14(26,27)16(30,31)32)11(20,21)13(24,25)15(28,29)17(33,34)45(39,40)42-4-3-41-6-1-2-7-8(5-6)43-9(36-7)44(35,37)38/h1-2,5H,3-4H2,(H2,35,37,38) |
| InChIKey | ZPMDXAPBRHPDIM-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 125.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.43 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|