C36H52N6O14 — CID 10843013
ditert-butyl 1-[2-[2-[4-[2-[2-[4,5-bis[(2-methylpropan-2-yl)oxycarbonyl]triazol-1-yl]ethoxy]ethoxy]-4-oxobut-2-ynoyl]oxyethoxy]ethyl]triazole-4,5-dicarboxylate (PubChem CID 10843013) has the molecular formula C36H52N6O14 and a molecular weight of 792.84 g/mol. Its IUPAC name is ditert-butyl 1-[2-[2-[4-[2-[2-[4,5-bis[(2-methylpropan-2-yl)oxycarbonyl]triazol-1-yl]ethoxy]ethoxy]-4-oxobut-2-ynoyl]oxyethoxy]ethyl]triazole-4,5-dicarboxylate.
| Compound Name | ditert-butyl 1-[2-[2-[4-[2-[2-[4,5-bis[(2-methylpropan-2-yl)oxycarbonyl]triazol-1-yl]ethoxy]ethoxy]-4-oxobut-2-ynoyl]oxyethoxy]ethyl]triazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 10843013 |
| Molecular Formula | C36H52N6O14 |
| Molecular Weight | 792.84 g/mol |
| Exact Mass | 792.35 |
| IUPAC Name | ditert-butyl 1-[2-[2-[4-[2-[2-[4,5-bis[(2-methylpropan-2-yl)oxycarbonyl]triazol-1-yl]ethoxy]ethoxy]-4-oxobut-2-ynoyl]oxyethoxy]ethyl]triazole-4,5-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)c1nnn(CCOCCOC(=O)C#CC(=O)OCCOCCn2nnc(C(=O)OC(C)(C)C)c2C(=O)OC(C)(C)C)c1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H52N6O14/c1-33(2,3)53-29(45)25-27(31(47)55-35(7,8)9)41(39-37-25)15-17-49-19-21-51-23(43)13-14-24(44)52-22-20-50-18-16-42-28(32(48)56-36(10,11)12)26(38-40-42)30(46)54-34(4,5)6/h15-22H2,1-12H3 |
| InChIKey | DJBAKFRHHDIOSW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 237.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.84 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|