C48H100O6Si4 — CID 10843357
(3R,5S,8R,9S,10R,12S)-12-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3,10-dimethyl-3,8,9-tris[tri(propan-2-yl)silyloxy]tridec-1-yn-7-one (PubChem CID 10843357) has the molecular formula C48H100O6Si4 and a molecular weight of 885.67 g/mol. Its IUPAC name is (3R,5S,8R,9S,10R,12S)-12-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3,10-dimethyl-3,8,9-tris[tri(propan-2-yl)silyloxy]tridec-1-yn-7-one.
| Compound Name | (3R,5S,8R,9S,10R,12S)-12-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3,10-dimethyl-3,8,9-tris[tri(propan-2-yl)silyloxy]tridec-1-yn-7-one |
|---|---|
| PubChem CID | 10843357 |
| Molecular Formula | C48H100O6Si4 |
| Molecular Weight | 885.67 g/mol |
| Exact Mass | 884.66 |
| IUPAC Name | (3R,5S,8R,9S,10R,12S)-12-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-3,10-dimethyl-3,8,9-tris[tri(propan-2-yl)silyloxy]tridec-1-yn-7-one |
| SMILES | C#C[C@@](C)(C[C@H](O)CC(=O)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)C[C@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C48H100O6Si4/c1-28-48(25,54-58(38(14)15,39(16)17)40(18)19)31-43(49)30-44(50)46(53-57(35(8)9,36(10)11)37(12)13)45(52-56(32(2)3,33(4)5)34(6)7)41(20)29-42(21)51-55(26,27)47(22,23)24/h1,32-43,45-46,49H,29-31H2,2-27H3/t41-,42+,43-,45+,46+,48+/m1/s1 |
| InChIKey | FMZNBFYKRIHVBY-FHMISAHJSA-N |
| XLogP | 14.84 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.67 |
| LogP ≤ 5 | 14.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|