C59H66O4Si2 — CID 10843386
ethyl 4-[(4-methoxyphenyl)methoxy]-3,5-bis[4-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]buta-1,3-diynyl]benzoate (PubChem CID 10843386) has the molecular formula C59H66O4Si2 and a molecular weight of 895.34 g/mol. Its IUPAC name is ethyl 4-[(4-methoxyphenyl)methoxy]-3,5-bis[4-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]buta-1,3-diynyl]benzoate.
| Compound Name | ethyl 4-[(4-methoxyphenyl)methoxy]-3,5-bis[4-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]buta-1,3-diynyl]benzoate |
|---|---|
| PubChem CID | 10843386 |
| Molecular Formula | C59H66O4Si2 |
| Molecular Weight | 895.34 g/mol |
| Exact Mass | 894.45 |
| IUPAC Name | ethyl 4-[(4-methoxyphenyl)methoxy]-3,5-bis[4-[4-[2-tri(propan-2-yl)silylethynyl]phenyl]buta-1,3-diynyl]benzoate |
| SMILES | CCOC(=O)c1cc(C#CC#Cc2ccc(C#C[Si](C(C)C)(C(C)C)C(C)C)cc2)c(OCc2ccc(OC)cc2)c(C#CC#Cc2ccc(C#C[Si](C(C)C)(C(C)C)C(C)C)cc2)c1 |
| InChI | InChI=1S/C59H66O4Si2/c1-15-62-59(60)56-40-54(22-18-16-20-49-24-28-51(29-25-49)36-38-64(43(2)3,44(4)5)45(6)7)58(63-42-53-32-34-57(61-14)35-33-53)55(41-56)23-19-17-21-50-26-30-52(31-27-50)37-39-65(46(8)9,47(10)11)48(12)13/h24-35,40-41,43-48H,15,42H2,1-14H3 |
| InChIKey | GGRKWWZCUIGNEW-UHFFFAOYSA-N |
| XLogP | 13.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.34 |
| LogP ≤ 5 | 13.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|