C60H59N5O5 — CID 10843499
benzyl N-[(2S)-1-oxo-1-[[2-oxo-2-(2-phenylpentylamino)ethyl]-[(4-phenylmethoxyphenyl)methyl]amino]-3-(1-tritylimidazol-4-yl)propan-2-yl]carbamate (PubChem CID 10843499) has the molecular formula C60H59N5O5 and a molecular weight of 930.16 g/mol. Its IUPAC name is benzyl N-[(2S)-1-oxo-1-[[2-oxo-2-(2-phenylpentylamino)ethyl]-[(4-phenylmethoxyphenyl)methyl]amino]-3-(1-tritylimidazol-4-yl)propan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-oxo-1-[[2-oxo-2-(2-phenylpentylamino)ethyl]-[(4-phenylmethoxyphenyl)methyl]amino]-3-(1-tritylimidazol-4-yl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 10843499 |
| Molecular Formula | C60H59N5O5 |
| Molecular Weight | 930.16 g/mol |
| Exact Mass | 929.45 |
| IUPAC Name | benzyl N-[(2S)-1-oxo-1-[[2-oxo-2-(2-phenylpentylamino)ethyl]-[(4-phenylmethoxyphenyl)methyl]amino]-3-(1-tritylimidazol-4-yl)propan-2-yl]carbamate |
| SMILES | CCCC(CNC(=O)CN(Cc1ccc(OCc2ccccc2)cc1)C(=O)[C@H](Cc1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1)NC(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C60H59N5O5/c1-2-21-50(49-26-13-5-14-27-49)39-61-57(66)42-64(40-46-34-36-55(37-35-46)69-43-47-22-9-3-10-23-47)58(67)56(63-59(68)70-44-48-24-11-4-12-25-48)38-54-41-65(45-62-54)60(51-28-15-6-16-29-51,52-30-17-7-18-31-52)53-32-19-8-20-33-53/h3-20,22-37,41,45,50,56H,2,21,38-40,42-44H2,1H3,(H,61,66)(H,63,68)/t50?,56-/m0/s1 |
| InChIKey | AGDFCVQQSYXZMG-HSRZVVATSA-N |
| XLogP | 10.87 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 930.16 |
| LogP ≤ 5 | 10.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|