About 2-amino-4-arsorosophenol;hydrochloride
2-amino-4-arsorosophenol;hydrochloride (PubChem CID 10844) has the molecular formula C6H7AsClNO2
and a molecular weight of 235.50 g/mol. Its IUPAC name is 2-amino-4-arsorosophenol;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-4-arsorosophenol;hydrochloride |
| PubChem CID | 10844 |
| Molecular Formula | C6H7AsClNO2 |
| Molecular Weight | 235.50 g/mol |
| Exact Mass | 234.94 |
| IUPAC Name | 2-amino-4-arsorosophenol;hydrochloride |
| SMILES | Cl.Nc1cc([As]=O)ccc1O |
| InChI | InChI=1S/C6H6AsNO2.ClH/c8-5-3-4(7-10)1-2-6(5)9;/h1-3,9H,8H2;1H |
| InChIKey | JRIGVWDKYXCHMG-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.50 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-arsorosophenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-arsorosophenol;hydrochloride?
The IUPAC name of 2-amino-4-arsorosophenol;hydrochloride (CID 10844) is 2-amino-4-arsorosophenol;hydrochloride.
What is the SMILES notation for 2-amino-4-arsorosophenol;hydrochloride?
The canonical SMILES for 2-amino-4-arsorosophenol;hydrochloride is Cl.Nc1cc([As]=O)ccc1O.
What is the InChIKey of 2-amino-4-arsorosophenol;hydrochloride?
The InChIKey is JRIGVWDKYXCHMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6AsNO2.ClH/c8-5-3-4(7-10)1-2-6(5)9;/h1-3,9H,8H2;1H.
What are the key properties of 2-amino-4-arsorosophenol;hydrochloride?
2-amino-4-arsorosophenol;hydrochloride has a molecular weight of 235.50 g/mol, XLogP of 0.07, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-arsorosophenol;hydrochloride is sourced from PubChem (CID 10844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).