About 5-(4-chlorophenyl)-N-(1,3-thiazol-2-yl)furan-2-carboxamide
5-(4-chlorophenyl)-N-(1,3-thiazol-2-yl)furan-2-carboxamide (PubChem CID 1084411) has the molecular formula C14H9ClN2O2S
and a molecular weight of 304.76 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(1,3-thiazol-2-yl)furan-2-carboxamide.
Molecular Properties
| Compound Name | 5-(4-chlorophenyl)-N-(1,3-thiazol-2-yl)furan-2-carboxamide |
| PubChem CID | 1084411 |
| Molecular Formula | C14H9ClN2O2S |
| Molecular Weight | 304.76 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(1,3-thiazol-2-yl)furan-2-carboxamide |
| SMILES | O=C(Nc1nccs1)c1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C14H9ClN2O2S/c15-10-3-1-9(2-4-10)11-5-6-12(19-11)13(18)17-14-16-7-8-20-14/h1-8H,(H,16,17,18) |
| InChIKey | BTJDPQCUBBJLPC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.76 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(4-chlorophenyl)-N-(1,3-thiazol-2-yl)furan-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chlorophenyl)-N-(1,3-thiazol-2-yl)furan-2-carboxamide?
The IUPAC name of 5-(4-chlorophenyl)-N-(1,3-thiazol-2-yl)furan-2-carboxamide (CID 1084411) is 5-(4-chlorophenyl)-N-(1,3-thiazol-2-yl)furan-2-carboxamide.
What is the SMILES notation for 5-(4-chlorophenyl)-N-(1,3-thiazol-2-yl)furan-2-carboxamide?
The canonical SMILES for 5-(4-chlorophenyl)-N-(1,3-thiazol-2-yl)furan-2-carboxamide is O=C(Nc1nccs1)c1ccc(-c2ccc(Cl)cc2)o1.
What is the InChIKey of 5-(4-chlorophenyl)-N-(1,3-thiazol-2-yl)furan-2-carboxamide?
The InChIKey is BTJDPQCUBBJLPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClN2O2S/c15-10-3-1-9(2-4-10)11-5-6-12(19-11)13(18)17-14-16-7-8-20-14/h1-8H,(H,16,17,18).
What are the key properties of 5-(4-chlorophenyl)-N-(1,3-thiazol-2-yl)furan-2-carboxamide?
5-(4-chlorophenyl)-N-(1,3-thiazol-2-yl)furan-2-carboxamide has a molecular weight of 304.76 g/mol, XLogP of 4.31, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chlorophenyl)-N-(1,3-thiazol-2-yl)furan-2-carboxamide is sourced from PubChem (CID 1084411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).