C23H24ClN3O3 — CID 10844296
3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-7-chloro-1H-quinazoline-2,4-dione (PubChem CID 10844296) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is 3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-7-chloro-1H-quinazoline-2,4-dione.
| Compound Name | 3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-7-chloro-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 10844296 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 3-[2-[(3aR,9bR)-6-methoxy-1,3,3a,4,5,9b-hexahydrobenzo[e]isoindol-2-yl]ethyl]-7-chloro-1H-quinazoline-2,4-dione |
| SMILES | COc1cccc2c1CC[C@H]1CN(CCn3c(=O)[nH]c4cc(Cl)ccc4c3=O)C[C@@H]21 |
| InChI | InChI=1S/C23H24ClN3O3/c1-30-21-4-2-3-16-17(21)7-5-14-12-26(13-19(14)16)9-10-27-22(28)18-8-6-15(24)11-20(18)25-23(27)29/h2-4,6,8,11,14,19H,5,7,9-10,12-13H2,1H3,(H,25,29)/t14-,19+/m0/s1 |
| InChIKey | YBNNEESMGJJPKH-IFXJQAMLSA-N |
| XLogP | 3.01 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |