About 6-iodo-2-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzothiazole
6-iodo-2-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzothiazole (PubChem CID 10844298) has the molecular formula C18H18IN3S
and a molecular weight of 435.33 g/mol. Its IUPAC name is 6-iodo-2-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 6-iodo-2-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzothiazole |
| PubChem CID | 10844298 |
| Molecular Formula | C18H18IN3S |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | 6-iodo-2-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzothiazole |
| SMILES | CN1CCN(c2ccc(-c3nc4ccc(I)cc4s3)cc2)CC1 |
| InChI | InChI=1S/C18H18IN3S/c1-21-8-10-22(11-9-21)15-5-2-13(3-6-15)18-20-16-7-4-14(19)12-17(16)23-18/h2-7,12H,8-11H2,1H3 |
| InChIKey | LGPNBDUEKJEVNY-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 6-iodo-2-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-iodo-2-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzothiazole?
The IUPAC name of 6-iodo-2-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzothiazole (CID 10844298) is 6-iodo-2-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzothiazole.
What is the SMILES notation for 6-iodo-2-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzothiazole?
The canonical SMILES for 6-iodo-2-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzothiazole is CN1CCN(c2ccc(-c3nc4ccc(I)cc4s3)cc2)CC1.
What is the InChIKey of 6-iodo-2-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzothiazole?
The InChIKey is LGPNBDUEKJEVNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18IN3S/c1-21-8-10-22(11-9-21)15-5-2-13(3-6-15)18-20-16-7-4-14(19)12-17(16)23-18/h2-7,12H,8-11H2,1H3.
What are the key properties of 6-iodo-2-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzothiazole?
6-iodo-2-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzothiazole has a molecular weight of 435.33 g/mol, XLogP of 4.32, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-iodo-2-[4-(4-methylpiperazin-1-yl)phenyl]-1,3-benzothiazole is sourced from PubChem (CID 10844298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).