About 1-cyclopentylpyrazole
1-cyclopentylpyrazole (PubChem CID 10844435) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 1-cyclopentylpyrazole.
Molecular Properties
| Compound Name | 1-cyclopentylpyrazole |
| PubChem CID | 10844435 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 1-cyclopentylpyrazole |
| SMILES | c1cnn(C2CCCC2)c1 |
| InChI | InChI=1S/C8H12N2/c1-2-5-8(4-1)10-7-3-6-9-10/h3,6-8H,1-2,4-5H2 |
| InChIKey | JZSAQAFZTUPWAR-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopentylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentylpyrazole?
The IUPAC name of 1-cyclopentylpyrazole (CID 10844435) is 1-cyclopentylpyrazole.
What is the SMILES notation for 1-cyclopentylpyrazole?
The canonical SMILES for 1-cyclopentylpyrazole is c1cnn(C2CCCC2)c1.
What is the InChIKey of 1-cyclopentylpyrazole?
The InChIKey is JZSAQAFZTUPWAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-2-5-8(4-1)10-7-3-6-9-10/h3,6-8H,1-2,4-5H2.
What are the key properties of 1-cyclopentylpyrazole?
1-cyclopentylpyrazole has a molecular weight of 136.20 g/mol, XLogP of 2.00, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentylpyrazole is sourced from PubChem (CID 10844435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).