About 1,1,2-trifluorohex-1-ene
1,1,2-trifluorohex-1-ene (PubChem CID 10844440) has the molecular formula C6H9F3
and a molecular weight of 138.13 g/mol. Its IUPAC name is 1,1,2-trifluorohex-1-ene.
Molecular Properties
| Compound Name | 1,1,2-trifluorohex-1-ene |
| PubChem CID | 10844440 |
| Molecular Formula | C6H9F3 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 1,1,2-trifluorohex-1-ene |
| SMILES | CCCCC(F)=C(F)F |
| InChI | InChI=1S/C6H9F3/c1-2-3-4-5(7)6(8)9/h2-4H2,1H3 |
| InChIKey | DOFGRVNGXJLKHG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1,2-trifluorohex-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2-trifluorohex-1-ene?
The IUPAC name of 1,1,2-trifluorohex-1-ene (CID 10844440) is 1,1,2-trifluorohex-1-ene.
What is the SMILES notation for 1,1,2-trifluorohex-1-ene?
The canonical SMILES for 1,1,2-trifluorohex-1-ene is CCCCC(F)=C(F)F.
What is the InChIKey of 1,1,2-trifluorohex-1-ene?
The InChIKey is DOFGRVNGXJLKHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9F3/c1-2-3-4-5(7)6(8)9/h2-4H2,1H3.
What are the key properties of 1,1,2-trifluorohex-1-ene?
1,1,2-trifluorohex-1-ene has a molecular weight of 138.13 g/mol, XLogP of 3.25, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2-trifluorohex-1-ene is sourced from PubChem (CID 10844440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).