About N,N-dimethyl-1,2-oxazole-5-carboxamide
N,N-dimethyl-1,2-oxazole-5-carboxamide (PubChem CID 10844452) has the molecular formula C6H8N2O2
and a molecular weight of 140.14 g/mol. Its IUPAC name is N,N-dimethyl-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N,N-dimethyl-1,2-oxazole-5-carboxamide |
| PubChem CID | 10844452 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | N,N-dimethyl-1,2-oxazole-5-carboxamide |
| SMILES | CN(C)C(=O)c1ccno1 |
| InChI | InChI=1S/C6H8N2O2/c1-8(2)6(9)5-3-4-7-10-5/h3-4H,1-2H3 |
| InChIKey | AHGOJJPVMFOGKL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dimethyl-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1,2-oxazole-5-carboxamide?
The IUPAC name of N,N-dimethyl-1,2-oxazole-5-carboxamide (CID 10844452) is N,N-dimethyl-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N,N-dimethyl-1,2-oxazole-5-carboxamide?
The canonical SMILES for N,N-dimethyl-1,2-oxazole-5-carboxamide is CN(C)C(=O)c1ccno1.
What is the InChIKey of N,N-dimethyl-1,2-oxazole-5-carboxamide?
The InChIKey is AHGOJJPVMFOGKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2/c1-8(2)6(9)5-3-4-7-10-5/h3-4H,1-2H3.
What are the key properties of N,N-dimethyl-1,2-oxazole-5-carboxamide?
N,N-dimethyl-1,2-oxazole-5-carboxamide has a molecular weight of 140.14 g/mol, XLogP of 0.38, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 10844452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).