About 3-methyl-3,4-diazabicyclo[4.1.0]heptane-2,5-dione
3-methyl-3,4-diazabicyclo[4.1.0]heptane-2,5-dione (PubChem CID 10844454) has the molecular formula C6H8N2O2
and a molecular weight of 140.14 g/mol. Its IUPAC name is 3-methyl-3,4-diazabicyclo[4.1.0]heptane-2,5-dione.
Molecular Properties
| Compound Name | 3-methyl-3,4-diazabicyclo[4.1.0]heptane-2,5-dione |
| PubChem CID | 10844454 |
| Molecular Formula | C6H8N2O2 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.06 |
| IUPAC Name | 3-methyl-3,4-diazabicyclo[4.1.0]heptane-2,5-dione |
| SMILES | CN1NC(=O)C2CC2C1=O |
| InChI | InChI=1S/C6H8N2O2/c1-8-6(10)4-2-3(4)5(9)7-8/h3-4H,2H2,1H3,(H,7,9) |
| InChIKey | ARHVCUDVPULNTH-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-3,4-diazabicyclo[4.1.0]heptane-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3,4-diazabicyclo[4.1.0]heptane-2,5-dione?
The IUPAC name of 3-methyl-3,4-diazabicyclo[4.1.0]heptane-2,5-dione (CID 10844454) is 3-methyl-3,4-diazabicyclo[4.1.0]heptane-2,5-dione.
What is the SMILES notation for 3-methyl-3,4-diazabicyclo[4.1.0]heptane-2,5-dione?
The canonical SMILES for 3-methyl-3,4-diazabicyclo[4.1.0]heptane-2,5-dione is CN1NC(=O)C2CC2C1=O.
What is the InChIKey of 3-methyl-3,4-diazabicyclo[4.1.0]heptane-2,5-dione?
The InChIKey is ARHVCUDVPULNTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2/c1-8-6(10)4-2-3(4)5(9)7-8/h3-4H,2H2,1H3,(H,7,9).
What are the key properties of 3-methyl-3,4-diazabicyclo[4.1.0]heptane-2,5-dione?
3-methyl-3,4-diazabicyclo[4.1.0]heptane-2,5-dione has a molecular weight of 140.14 g/mol, XLogP of -0.87, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3,4-diazabicyclo[4.1.0]heptane-2,5-dione is sourced from PubChem (CID 10844454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).