C8H12O2 — CID 10844458
(1S,3S,5S,7S)-tricyclo[3.3.0.03,7]octane-2,6-diol (PubChem CID 10844458) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is (1S,3S,5S,7S)-tricyclo[3.3.0.03,7]octane-2,6-diol.
| Compound Name | (1S,3S,5S,7S)-tricyclo[3.3.0.03,7]octane-2,6-diol |
|---|---|
| PubChem CID | 10844458 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (1S,3S,5S,7S)-tricyclo[3.3.0.03,7]octane-2,6-diol |
| SMILES | OC1[C@H]2C[C@@H]3C(O)[C@H]2C[C@H]13 |
| InChI | InChI=1S/C8H12O2/c9-7-3-1-4-6(7)2-5(3)8(4)10/h3-10H,1-2H2/t3-,4-,5-,6-,7?,8?/m0/s1 |
| InChIKey | DEZZVLQETJEPHD-MRTQZFPLSA-N |
| XLogP | -0.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |