About (4R,5R)-4,5-diethyl-2-methyl-4,5-dihydro-1,3-oxazole
(4R,5R)-4,5-diethyl-2-methyl-4,5-dihydro-1,3-oxazole (PubChem CID 10844474) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is (4R,5R)-4,5-diethyl-2-methyl-4,5-dihydro-1,3-oxazole.
Analyze (4R,5R)-4,5-diethyl-2-methyl-4,5-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5R)-4,5-diethyl-2-methyl-4,5-dihydro-1,3-oxazole?
The IUPAC name of (4R,5R)-4,5-diethyl-2-methyl-4,5-dihydro-1,3-oxazole (CID 10844474) is (4R,5R)-4,5-diethyl-2-methyl-4,5-dihydro-1,3-oxazole.
What is the SMILES notation for (4R,5R)-4,5-diethyl-2-methyl-4,5-dihydro-1,3-oxazole?
The canonical SMILES for (4R,5R)-4,5-diethyl-2-methyl-4,5-dihydro-1,3-oxazole is CC[C@H]1N=C(C)O[C@@H]1CC.
What is the InChIKey of (4R,5R)-4,5-diethyl-2-methyl-4,5-dihydro-1,3-oxazole?
The InChIKey is RVBAFEHAHFBYQG-HTQZYQBOSA-N. The full InChI is InChI=1S/C8H15NO/c1-4-7-8(5-2)10-6(3)9-7/h7-8H,4-5H2,1-3H3/t7-,8-/m1/s1.
What are the key properties of (4R,5R)-4,5-diethyl-2-methyl-4,5-dihydro-1,3-oxazole?
(4R,5R)-4,5-diethyl-2-methyl-4,5-dihydro-1,3-oxazole has a molecular weight of 141.21 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5R)-4,5-diethyl-2-methyl-4,5-dihydro-1,3-oxazole is sourced from PubChem (CID 10844474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).