About 2,7,8-trimethylpurine
2,7,8-trimethylpurine (PubChem CID 10844724) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 2,7,8-trimethylpurine.
Molecular Properties
| Compound Name | 2,7,8-trimethylpurine |
| PubChem CID | 10844724 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 2,7,8-trimethylpurine |
| SMILES | Cc1ncc2c(n1)nc(C)n2C |
| InChI | InChI=1S/C8H10N4/c1-5-9-4-7-8(10-5)11-6(2)12(7)3/h4H,1-3H3 |
| InChIKey | OEKARZQMWOOFBX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,7,8-trimethylpurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7,8-trimethylpurine?
The IUPAC name of 2,7,8-trimethylpurine (CID 10844724) is 2,7,8-trimethylpurine.
What is the SMILES notation for 2,7,8-trimethylpurine?
The canonical SMILES for 2,7,8-trimethylpurine is Cc1ncc2c(n1)nc(C)n2C.
What is the InChIKey of 2,7,8-trimethylpurine?
The InChIKey is OEKARZQMWOOFBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-5-9-4-7-8(10-5)11-6(2)12(7)3/h4H,1-3H3.
What are the key properties of 2,7,8-trimethylpurine?
2,7,8-trimethylpurine has a molecular weight of 162.20 g/mol, XLogP of 0.98, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7,8-trimethylpurine is sourced from PubChem (CID 10844724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).