About [(2E)-hexa-2,5-dien-2-yl]oxycyclohexane
[(2E)-hexa-2,5-dien-2-yl]oxycyclohexane (PubChem CID 10845101) has the molecular formula C12H20O
and a molecular weight of 180.29 g/mol. Its IUPAC name is [(2E)-hexa-2,5-dien-2-yl]oxycyclohexane.
Molecular Properties
| Compound Name | [(2E)-hexa-2,5-dien-2-yl]oxycyclohexane |
| PubChem CID | 10845101 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | [(2E)-hexa-2,5-dien-2-yl]oxycyclohexane |
| SMILES | C=CC/C=C(\C)OC1CCCCC1 |
| InChI | InChI=1S/C12H20O/c1-3-4-8-11(2)13-12-9-6-5-7-10-12/h3,8,12H,1,4-7,9-10H2,2H3/b11-8+ |
| InChIKey | MOBGZLLIUXJFCK-DHZHZOJOSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2E)-hexa-2,5-dien-2-yl]oxycyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E)-hexa-2,5-dien-2-yl]oxycyclohexane?
The IUPAC name of [(2E)-hexa-2,5-dien-2-yl]oxycyclohexane (CID 10845101) is [(2E)-hexa-2,5-dien-2-yl]oxycyclohexane.
What is the SMILES notation for [(2E)-hexa-2,5-dien-2-yl]oxycyclohexane?
The canonical SMILES for [(2E)-hexa-2,5-dien-2-yl]oxycyclohexane is C=CC/C=C(\C)OC1CCCCC1.
What is the InChIKey of [(2E)-hexa-2,5-dien-2-yl]oxycyclohexane?
The InChIKey is MOBGZLLIUXJFCK-DHZHZOJOSA-N. The full InChI is InChI=1S/C12H20O/c1-3-4-8-11(2)13-12-9-6-5-7-10-12/h3,8,12H,1,4-7,9-10H2,2H3/b11-8+.
What are the key properties of [(2E)-hexa-2,5-dien-2-yl]oxycyclohexane?
[(2E)-hexa-2,5-dien-2-yl]oxycyclohexane has a molecular weight of 180.29 g/mol, XLogP of 3.82, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E)-hexa-2,5-dien-2-yl]oxycyclohexane is sourced from PubChem (CID 10845101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).