C9H13NO3 — CID 10845174
(5S,8S,8aR)-5-ethenyl-8-hydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 10845174) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is (5S,8S,8aR)-5-ethenyl-8-hydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | (5S,8S,8aR)-5-ethenyl-8-hydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 10845174 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | (5S,8S,8aR)-5-ethenyl-8-hydroxy-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | C=C[C@@H]1CC[C@H](O)[C@H]2COC(=O)N12 |
| InChI | InChI=1S/C9H13NO3/c1-2-6-3-4-8(11)7-5-13-9(12)10(6)7/h2,6-8,11H,1,3-5H2/t6-,7-,8+/m1/s1 |
| InChIKey | WURXCIBOKCVESH-PRJMDXOYSA-N |
| XLogP | 0.52 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|