About 1-(3-acetyl-5-hydroxy-1,3-diazinan-1-yl)ethanone
1-(3-acetyl-5-hydroxy-1,3-diazinan-1-yl)ethanone (PubChem CID 10845230) has the molecular formula C8H14N2O3
and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-(3-acetyl-5-hydroxy-1,3-diazinan-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3-acetyl-5-hydroxy-1,3-diazinan-1-yl)ethanone |
| PubChem CID | 10845230 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 1-(3-acetyl-5-hydroxy-1,3-diazinan-1-yl)ethanone |
| SMILES | CC(=O)N1CC(O)CN(C(C)=O)C1 |
| InChI | InChI=1S/C8H14N2O3/c1-6(11)9-3-8(13)4-10(5-9)7(2)12/h8,13H,3-5H2,1-2H3 |
| InChIKey | MMKBXSSBUWACPX-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-acetyl-5-hydroxy-1,3-diazinan-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-acetyl-5-hydroxy-1,3-diazinan-1-yl)ethanone?
The IUPAC name of 1-(3-acetyl-5-hydroxy-1,3-diazinan-1-yl)ethanone (CID 10845230) is 1-(3-acetyl-5-hydroxy-1,3-diazinan-1-yl)ethanone.
What is the SMILES notation for 1-(3-acetyl-5-hydroxy-1,3-diazinan-1-yl)ethanone?
The canonical SMILES for 1-(3-acetyl-5-hydroxy-1,3-diazinan-1-yl)ethanone is CC(=O)N1CC(O)CN(C(C)=O)C1.
What is the InChIKey of 1-(3-acetyl-5-hydroxy-1,3-diazinan-1-yl)ethanone?
The InChIKey is MMKBXSSBUWACPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O3/c1-6(11)9-3-8(13)4-10(5-9)7(2)12/h8,13H,3-5H2,1-2H3.
What are the key properties of 1-(3-acetyl-5-hydroxy-1,3-diazinan-1-yl)ethanone?
1-(3-acetyl-5-hydroxy-1,3-diazinan-1-yl)ethanone has a molecular weight of 186.21 g/mol, XLogP of -0.98, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-acetyl-5-hydroxy-1,3-diazinan-1-yl)ethanone is sourced from PubChem (CID 10845230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).