C7H19N3 — CID 10845260
N'-(3-(15N)azanylpropyl)(1,4-13C2)butane-1,4-di(15N2)amine (PubChem CID 10845260) has the molecular formula C7H19N3 and a molecular weight of 150.21 g/mol. Its IUPAC name is N'-(3-(15N)azanylpropyl)(1,4-13C2)butane-1,4-di(15N2)amine.
| Compound Name | N'-(3-(15N)azanylpropyl)(1,4-13C2)butane-1,4-di(15N2)amine |
|---|---|
| PubChem CID | 10845260 |
| Molecular Formula | C7H19N3 |
| Molecular Weight | 150.21 g/mol |
| Exact Mass | 150.16 |
| IUPAC Name | N'-(3-(15N)azanylpropyl)(1,4-13C2)butane-1,4-di(15N2)amine |
| SMILES | [15NH2]CCC[15NH][13CH2]CC[13CH2][15NH2] |
| InChI | InChI=1S/C7H19N3/c8-4-1-2-6-10-7-3-5-9/h10H,1-9H2/i4+1,6+1,8+1,9+1,10+1 |
| InChIKey | ATHGHQPFGPMSJY-LFXUASNSSA-N |
| XLogP | -0.34 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.21 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|