About 4-(2-aminoethyl)-N,N-dimethylthian-4-amine
4-(2-aminoethyl)-N,N-dimethylthian-4-amine (PubChem CID 10845314) has the molecular formula C9H20N2S
and a molecular weight of 188.34 g/mol. Its IUPAC name is 4-(2-aminoethyl)-N,N-dimethylthian-4-amine.
Molecular Properties
| Compound Name | 4-(2-aminoethyl)-N,N-dimethylthian-4-amine |
| PubChem CID | 10845314 |
| Molecular Formula | C9H20N2S |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 4-(2-aminoethyl)-N,N-dimethylthian-4-amine |
| SMILES | CN(C)C1(CCN)CCSCC1 |
| InChI | InChI=1S/C9H20N2S/c1-11(2)9(3-6-10)4-7-12-8-5-9/h3-8,10H2,1-2H3 |
| InChIKey | WWQVVJZHSJTPCE-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-aminoethyl)-N,N-dimethylthian-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethyl)-N,N-dimethylthian-4-amine?
The IUPAC name of 4-(2-aminoethyl)-N,N-dimethylthian-4-amine (CID 10845314) is 4-(2-aminoethyl)-N,N-dimethylthian-4-amine.
What is the SMILES notation for 4-(2-aminoethyl)-N,N-dimethylthian-4-amine?
The canonical SMILES for 4-(2-aminoethyl)-N,N-dimethylthian-4-amine is CN(C)C1(CCN)CCSCC1.
What is the InChIKey of 4-(2-aminoethyl)-N,N-dimethylthian-4-amine?
The InChIKey is WWQVVJZHSJTPCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2S/c1-11(2)9(3-6-10)4-7-12-8-5-9/h3-8,10H2,1-2H3.
What are the key properties of 4-(2-aminoethyl)-N,N-dimethylthian-4-amine?
4-(2-aminoethyl)-N,N-dimethylthian-4-amine has a molecular weight of 188.34 g/mol, XLogP of 1.16, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethyl)-N,N-dimethylthian-4-amine is sourced from PubChem (CID 10845314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).