C9H16N2 — CID 10845319
6-prop-2-enyl-3,4,5,6-tetrahydro-2H-azepin-7-amine (PubChem CID 10845319) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 6-prop-2-enyl-3,4,5,6-tetrahydro-2H-azepin-7-amine.
| Compound Name | 6-prop-2-enyl-3,4,5,6-tetrahydro-2H-azepin-7-amine |
|---|---|
| PubChem CID | 10845319 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 6-prop-2-enyl-3,4,5,6-tetrahydro-2H-azepin-7-amine |
| SMILES | C=CCC1CCCCN=C1N |
| InChI | InChI=1S/C9H16N2/c1-2-5-8-6-3-4-7-11-9(8)10/h2,8H,1,3-7H2,(H2,10,11) |
| InChIKey | ZEGJDBHGDIIMLI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|