C9H7FN2S — CID 10845487
3-fluoro-4-(4-methylphenyl)-1,2,5-thiadiazole (PubChem CID 10845487) has the molecular formula C9H7FN2S and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-fluoro-4-(4-methylphenyl)-1,2,5-thiadiazole.
| Compound Name | 3-fluoro-4-(4-methylphenyl)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 10845487 |
| Molecular Formula | C9H7FN2S |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | 3-fluoro-4-(4-methylphenyl)-1,2,5-thiadiazole |
| SMILES | Cc1ccc(-c2nsnc2F)cc1 |
| InChI | InChI=1S/C9H7FN2S/c1-6-2-4-7(5-3-6)8-9(10)12-13-11-8/h2-5H,1H3 |
| InChIKey | PRVNTYYLLDDFEE-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |