C12H18O2 — CID 10845498
2-(6-methyl-2,5-dihydropyran-6-yl)-2,3,4,7-tetrahydrooxepine (PubChem CID 10845498) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 2-(6-methyl-2,5-dihydropyran-6-yl)-2,3,4,7-tetrahydrooxepine.
| Compound Name | 2-(6-methyl-2,5-dihydropyran-6-yl)-2,3,4,7-tetrahydrooxepine |
|---|---|
| PubChem CID | 10845498 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2-(6-methyl-2,5-dihydropyran-6-yl)-2,3,4,7-tetrahydrooxepine |
| SMILES | CC1(C2CCC=CCO2)CC=CCO1 |
| InChI | InChI=1S/C12H18O2/c1-12(8-4-6-10-14-12)11-7-3-2-5-9-13-11/h2,4-6,11H,3,7-10H2,1H3 |
| InChIKey | GIWHECNBZQSMGH-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|