About 2-sulfanylidene-3,4-dihydro-1H-imidazo[1,5-a]pyrimidine-8-carboxamide
2-sulfanylidene-3,4-dihydro-1H-imidazo[1,5-a]pyrimidine-8-carboxamide (PubChem CID 10845548) has the molecular formula C7H8N4OS
and a molecular weight of 196.23 g/mol. Its IUPAC name is 2-sulfanylidene-3,4-dihydro-1H-imidazo[1,5-a]pyrimidine-8-carboxamide.
Molecular Properties
| Compound Name | 2-sulfanylidene-3,4-dihydro-1H-imidazo[1,5-a]pyrimidine-8-carboxamide |
| PubChem CID | 10845548 |
| Molecular Formula | C7H8N4OS |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | 2-sulfanylidene-3,4-dihydro-1H-imidazo[1,5-a]pyrimidine-8-carboxamide |
| SMILES | NC(=O)c1ncn2c1NC(=S)CC2 |
| InChI | InChI=1S/C7H8N4OS/c8-6(12)5-7-10-4(13)1-2-11(7)3-9-5/h3H,1-2H2,(H2,8,12)(H,10,13) |
| InChIKey | XQDAIXZCTCKWTJ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylidene-3,4-dihydro-1H-imidazo[1,5-a]pyrimidine-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylidene-3,4-dihydro-1H-imidazo[1,5-a]pyrimidine-8-carboxamide?
The IUPAC name of 2-sulfanylidene-3,4-dihydro-1H-imidazo[1,5-a]pyrimidine-8-carboxamide (CID 10845548) is 2-sulfanylidene-3,4-dihydro-1H-imidazo[1,5-a]pyrimidine-8-carboxamide.
What is the SMILES notation for 2-sulfanylidene-3,4-dihydro-1H-imidazo[1,5-a]pyrimidine-8-carboxamide?
The canonical SMILES for 2-sulfanylidene-3,4-dihydro-1H-imidazo[1,5-a]pyrimidine-8-carboxamide is NC(=O)c1ncn2c1NC(=S)CC2.
What is the InChIKey of 2-sulfanylidene-3,4-dihydro-1H-imidazo[1,5-a]pyrimidine-8-carboxamide?
The InChIKey is XQDAIXZCTCKWTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4OS/c8-6(12)5-7-10-4(13)1-2-11(7)3-9-5/h3H,1-2H2,(H2,8,12)(H,10,13).
What are the key properties of 2-sulfanylidene-3,4-dihydro-1H-imidazo[1,5-a]pyrimidine-8-carboxamide?
2-sulfanylidene-3,4-dihydro-1H-imidazo[1,5-a]pyrimidine-8-carboxamide has a molecular weight of 196.23 g/mol, XLogP of 0.12, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylidene-3,4-dihydro-1H-imidazo[1,5-a]pyrimidine-8-carboxamide is sourced from PubChem (CID 10845548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).