About (2E)-6,6-dimethyl-2-(2-methylpropylidene)-4,8-dioxaspiro[2.5]octane
(2E)-6,6-dimethyl-2-(2-methylpropylidene)-4,8-dioxaspiro[2.5]octane (PubChem CID 10845571) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is (2E)-6,6-dimethyl-2-(2-methylpropylidene)-4,8-dioxaspiro[2.5]octane.
Molecular Properties
| Compound Name | (2E)-6,6-dimethyl-2-(2-methylpropylidene)-4,8-dioxaspiro[2.5]octane |
| PubChem CID | 10845571 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (2E)-6,6-dimethyl-2-(2-methylpropylidene)-4,8-dioxaspiro[2.5]octane |
| SMILES | CC(C)/C=C1\CC12OCC(C)(C)CO2 |
| InChI | InChI=1S/C12H20O2/c1-9(2)5-10-6-12(10)13-7-11(3,4)8-14-12/h5,9H,6-8H2,1-4H3/b10-5+ |
| InChIKey | YAOHUEULTGOUTL-BJMVGYQFSA-N |
| XLogP | 2.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-6,6-dimethyl-2-(2-methylpropylidene)-4,8-dioxaspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-6,6-dimethyl-2-(2-methylpropylidene)-4,8-dioxaspiro[2.5]octane?
The IUPAC name of (2E)-6,6-dimethyl-2-(2-methylpropylidene)-4,8-dioxaspiro[2.5]octane (CID 10845571) is (2E)-6,6-dimethyl-2-(2-methylpropylidene)-4,8-dioxaspiro[2.5]octane.
What is the SMILES notation for (2E)-6,6-dimethyl-2-(2-methylpropylidene)-4,8-dioxaspiro[2.5]octane?
The canonical SMILES for (2E)-6,6-dimethyl-2-(2-methylpropylidene)-4,8-dioxaspiro[2.5]octane is CC(C)/C=C1\CC12OCC(C)(C)CO2.
What is the InChIKey of (2E)-6,6-dimethyl-2-(2-methylpropylidene)-4,8-dioxaspiro[2.5]octane?
The InChIKey is YAOHUEULTGOUTL-BJMVGYQFSA-N. The full InChI is InChI=1S/C12H20O2/c1-9(2)5-10-6-12(10)13-7-11(3,4)8-14-12/h5,9H,6-8H2,1-4H3/b10-5+.
What are the key properties of (2E)-6,6-dimethyl-2-(2-methylpropylidene)-4,8-dioxaspiro[2.5]octane?
(2E)-6,6-dimethyl-2-(2-methylpropylidene)-4,8-dioxaspiro[2.5]octane has a molecular weight of 196.29 g/mol, XLogP of 2.74, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-6,6-dimethyl-2-(2-methylpropylidene)-4,8-dioxaspiro[2.5]octane is sourced from PubChem (CID 10845571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).