C13H14O2 — CID 10845784
(3aR,10aS)-1,3,3a,4,5,6-hexahydrocyclopenta[j]naphthalene-2,8-dione (PubChem CID 10845784) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is (3aR,10aS)-1,3,3a,4,5,6-hexahydrocyclopenta[j]naphthalene-2,8-dione.
| Compound Name | (3aR,10aS)-1,3,3a,4,5,6-hexahydrocyclopenta[j]naphthalene-2,8-dione |
|---|---|
| PubChem CID | 10845784 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (3aR,10aS)-1,3,3a,4,5,6-hexahydrocyclopenta[j]naphthalene-2,8-dione |
| SMILES | O=C1C=C[C@]23CC(=O)C[C@H]2CCCC3=C1 |
| InChI | InChI=1S/C13H14O2/c14-11-4-5-13-8-12(15)7-10(13)3-1-2-9(13)6-11/h4-6,10H,1-3,7-8H2/t10-,13-/m1/s1 |
| InChIKey | KKYGTMDQQDHAGW-ZWNOBZJWSA-N |
| XLogP | 2.20 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |