C13H20O2 — CID 10846053
(4E,6E,10E)-trideca-4,6,10,12-tetraene-2,8-diol (PubChem CID 10846053) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is (4E,6E,10E)-trideca-4,6,10,12-tetraene-2,8-diol.
| Compound Name | (4E,6E,10E)-trideca-4,6,10,12-tetraene-2,8-diol |
|---|---|
| PubChem CID | 10846053 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | (4E,6E,10E)-trideca-4,6,10,12-tetraene-2,8-diol |
| SMILES | C=C/C=C/CC(O)/C=C/C=C/CC(C)O |
| InChI | InChI=1S/C13H20O2/c1-3-4-6-10-13(15)11-8-5-7-9-12(2)14/h3-8,11-15H,1,9-10H2,2H3/b6-4+,7-5+,11-8+ |
| InChIKey | QPSDEVHCBILQEK-RHEQMUENSA-N |
| XLogP | 2.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|