C8H16F2N2O2 — CID 10846113
(3R,4S)-4-amino-2,2-difluoro-3-hydroxy-N,5-dimethylhexanamide (PubChem CID 10846113) has the molecular formula C8H16F2N2O2 and a molecular weight of 210.22 g/mol. Its IUPAC name is (3R,4S)-4-amino-2,2-difluoro-3-hydroxy-N,5-dimethylhexanamide.
| Compound Name | (3R,4S)-4-amino-2,2-difluoro-3-hydroxy-N,5-dimethylhexanamide |
|---|---|
| PubChem CID | 10846113 |
| Molecular Formula | C8H16F2N2O2 |
| Molecular Weight | 210.22 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | (3R,4S)-4-amino-2,2-difluoro-3-hydroxy-N,5-dimethylhexanamide |
| SMILES | CNC(=O)C(F)(F)[C@H](O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C8H16F2N2O2/c1-4(2)5(11)6(13)8(9,10)7(14)12-3/h4-6,13H,11H2,1-3H3,(H,12,14)/t5-,6+/m0/s1 |
| InChIKey | ODYGVJPZTVKSOK-NTSWFWBYSA-N |
| XLogP | -0.29 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.22 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |