About 1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethanone
1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethanone (PubChem CID 10846210) has the molecular formula C9H12N2O2S
and a molecular weight of 212.27 g/mol. Its IUPAC name is 1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethanone |
| PubChem CID | 10846210 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethanone |
| SMILES | CC(=O)c1cnc(N2CCOCC2)s1 |
| InChI | InChI=1S/C9H12N2O2S/c1-7(12)8-6-10-9(14-8)11-2-4-13-5-3-11/h6H,2-5H2,1H3 |
| InChIKey | ONDPYLJMVWWKFR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethanone?
The IUPAC name of 1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethanone (CID 10846210) is 1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethanone.
What is the SMILES notation for 1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethanone?
The canonical SMILES for 1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethanone is CC(=O)c1cnc(N2CCOCC2)s1.
What is the InChIKey of 1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethanone?
The InChIKey is ONDPYLJMVWWKFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2S/c1-7(12)8-6-10-9(14-8)11-2-4-13-5-3-11/h6H,2-5H2,1H3.
What are the key properties of 1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethanone?
1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethanone has a molecular weight of 212.27 g/mol, XLogP of 1.18, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-morpholin-4-yl-1,3-thiazol-5-yl)ethanone is sourced from PubChem (CID 10846210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).