About tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate
tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate (PubChem CID 10846278) has the molecular formula C10H14O5
and a molecular weight of 214.22 g/mol. Its IUPAC name is tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate.
Molecular Properties
| Compound Name | tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate |
| PubChem CID | 10846278 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate |
| SMILES | CO/C=C/C(=O)C(=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H14O5/c1-10(2,3)15-9(13)8(12)7(11)5-6-14-4/h5-6H,1-4H3/b6-5+ |
| InChIKey | JNWDDRXWOOCTBQ-AATRIKPKSA-N |
| XLogP | 0.63 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate?
The IUPAC name of tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate (CID 10846278) is tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate.
What is the SMILES notation for tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate?
The canonical SMILES for tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate is CO/C=C/C(=O)C(=O)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate?
The InChIKey is JNWDDRXWOOCTBQ-AATRIKPKSA-N. The full InChI is InChI=1S/C10H14O5/c1-10(2,3)15-9(13)8(12)7(11)5-6-14-4/h5-6H,1-4H3/b6-5+.
What are the key properties of tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate?
tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate has a molecular weight of 214.22 g/mol, XLogP of 0.63, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (E)-5-methoxy-2,3-dioxopent-4-enoate is sourced from PubChem (CID 10846278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).