C14H14O2 — CID 10846300
(2E,5R)-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]dec-3-ene (PubChem CID 10846300) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is (2E,5R)-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]dec-3-ene.
| Compound Name | (2E,5R)-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]dec-3-ene |
|---|---|
| PubChem CID | 10846300 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | (2E,5R)-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]dec-3-ene |
| SMILES | CC#CC#C/C=C1\C=C[C@@]2(CCCCO2)O1 |
| InChI | InChI=1S/C14H14O2/c1-2-3-4-5-8-13-9-11-14(16-13)10-6-7-12-15-14/h8-9,11H,6-7,10,12H2,1H3/b13-8+/t14-/m1/s1 |
| InChIKey | RNEORCMLRJNFGE-MAUPQMMJSA-N |
| XLogP | 2.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|