About 1-methylphenoxathiine
1-methylphenoxathiine (PubChem CID 10846307) has the molecular formula C13H10OS
and a molecular weight of 214.29 g/mol. Its IUPAC name is 1-methylphenoxathiine.
Molecular Properties
| Compound Name | 1-methylphenoxathiine |
| PubChem CID | 10846307 |
| Molecular Formula | C13H10OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 1-methylphenoxathiine |
| SMILES | Cc1cccc2c1Sc1ccccc1O2 |
| InChI | InChI=1S/C13H10OS/c1-9-5-4-7-11-13(9)15-12-8-3-2-6-10(12)14-11/h2-8H,1H3 |
| InChIKey | UGFMYKUFBSSFKP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methylphenoxathiine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylphenoxathiine?
The IUPAC name of 1-methylphenoxathiine (CID 10846307) is 1-methylphenoxathiine.
What is the SMILES notation for 1-methylphenoxathiine?
The canonical SMILES for 1-methylphenoxathiine is Cc1cccc2c1Sc1ccccc1O2.
What is the InChIKey of 1-methylphenoxathiine?
The InChIKey is UGFMYKUFBSSFKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10OS/c1-9-5-4-7-11-13(9)15-12-8-3-2-6-10(12)14-11/h2-8H,1H3.
What are the key properties of 1-methylphenoxathiine?
1-methylphenoxathiine has a molecular weight of 214.29 g/mol, XLogP of 4.25, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylphenoxathiine is sourced from PubChem (CID 10846307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).